C14H24O6S2 — CID 102171059
(4S)-4-[(4S,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoic acid (PubChem CID 102171059) has the molecular formula C14H24O6S2 and a molecular weight of 352.47 g/mol. Its IUPAC name is (4S)-4-[(4S,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoic acid.
| Compound Name | (4S)-4-[(4S,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoic acid |
|---|---|
| PubChem CID | 102171059 |
| Molecular Formula | C14H24O6S2 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (4S)-4-[(4S,5S)-5-[bis(ethylsulfanyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoic acid |
| SMILES | CCSC(SCC)[C@H]1OC(C)(C)O[C@H]1[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C14H24O6S2/c1-5-21-13(22-6-2)11-10(19-14(3,4)20-11)8(15)7-9(16)12(17)18/h8,10-11,13,15H,5-7H2,1-4H3,(H,17,18)/t8-,10-,11-/m0/s1 |
| InChIKey | NKVZZACEYAGXGV-LSJOCFKGSA-N |
| XLogP | 1.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|