C15H28O5S — CID 11313234
(3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-nonylsulfanylethyl]oxolan-2-one (PubChem CID 11313234) has the molecular formula C15H28O5S and a molecular weight of 320.45 g/mol. Its IUPAC name is (3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-nonylsulfanylethyl]oxolan-2-one.
| Compound Name | (3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-nonylsulfanylethyl]oxolan-2-one |
|---|---|
| PubChem CID | 11313234 |
| Molecular Formula | C15H28O5S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-nonylsulfanylethyl]oxolan-2-one |
| SMILES | CCCCCCCCCSC[C@@H](O)[C@H]1OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H28O5S/c1-2-3-4-5-6-7-8-9-21-10-11(16)14-12(17)13(18)15(19)20-14/h11-14,16-18H,2-10H2,1H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | VOYIFOYURWSMAC-YIYPIFLZSA-N |
| XLogP | 1.48 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|