C14H28O6S — CID 141127951
S-octyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate (PubChem CID 141127951) has the molecular formula C14H28O6S and a molecular weight of 324.44 g/mol. Its IUPAC name is S-octyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate.
| Compound Name | S-octyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
|---|---|
| PubChem CID | 141127951 |
| Molecular Formula | C14H28O6S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | S-octyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
| SMILES | CCCCCCCCSC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H28O6S/c1-2-3-4-5-6-7-8-21-14(20)13(19)12(18)11(17)10(16)9-15/h10-13,15-19H,2-9H2,1H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | ALKVLGGVFAYBNX-FVCCEPFGSA-N |
| XLogP | 0.04 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|