C9H18O7S — CID 141165883
S-(2-hydroxypropyl) (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate (PubChem CID 141165883) has the molecular formula C9H18O7S and a molecular weight of 270.30 g/mol. Its IUPAC name is S-(2-hydroxypropyl) (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate.
| Compound Name | S-(2-hydroxypropyl) (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
|---|---|
| PubChem CID | 141165883 |
| Molecular Formula | C9H18O7S |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | S-(2-hydroxypropyl) (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanethioate |
| SMILES | CC(O)CSC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O7S/c1-4(11)3-17-9(16)8(15)7(14)6(13)5(12)2-10/h4-8,10-15H,2-3H2,1H3/t4?,5-,6-,7+,8-/m1/s1 |
| InChIKey | QTRFGYKNOFIGBD-PXUUIUOKSA-N |
| XLogP | -2.94 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|