About 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran
6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 90957440) has the molecular formula C9H15FO
and a molecular weight of 158.22 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran.
Analyze 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran?
The IUPAC name of 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran (CID 90957440) is 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran is CC1=C(C(C)F)OC(C)CC1.
What is the InChIKey of 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran?
The InChIKey is FWOTWUCMBLZQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FO/c1-6-4-5-7(2)11-9(6)8(3)10/h7-8H,4-5H2,1-3H3.
What are the key properties of 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran?
6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran has a molecular weight of 158.22 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-fluoroethyl)-2,5-dimethyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 90957440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).