C13H21FO — CID 142490374
2-fluoro-4-hexan-3-yloxy-1-methylcyclohexa-1,3-diene (PubChem CID 142490374) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-fluoro-4-hexan-3-yloxy-1-methylcyclohexa-1,3-diene.
| Compound Name | 2-fluoro-4-hexan-3-yloxy-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142490374 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-fluoro-4-hexan-3-yloxy-1-methylcyclohexa-1,3-diene |
| SMILES | CCCC(CC)OC1=CC(F)=C(C)CC1 |
| InChI | InChI=1S/C13H21FO/c1-4-6-11(5-2)15-12-8-7-10(3)13(14)9-12/h9,11H,4-8H2,1-3H3 |
| InChIKey | RAGJDVJKDPLGOQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |