C10H21N — CID 90957590
2,4-dimethyl-2H-pyrrole;ethane (PubChem CID 90957590) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 2,4-dimethyl-2H-pyrrole;ethane.
| Compound Name | 2,4-dimethyl-2H-pyrrole;ethane |
|---|---|
| PubChem CID | 90957590 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 2,4-dimethyl-2H-pyrrole;ethane |
| SMILES | CC.CC.CC1=CC(C)N=C1 |
| InChI | InChI=1S/C6H9N.2C2H6/c1-5-3-6(2)7-4-5;2*1-2/h3-4,6H,1-2H3;2*1-2H3 |
| InChIKey | GNUQYHORSLEZLL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |