About bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate
bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate (PubChem CID 90958921) has the molecular formula C26H51NO6
and a molecular weight of 473.70 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate |
| PubChem CID | 90958921 |
| Molecular Formula | C26H51NO6 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate |
| SMILES | CCCCC(CC)COC(=O)CC(C)C(=O)OCC(CC)CCCC.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C21H40O4.C5H11NO2/c1-6-10-12-18(8-3)15-24-20(22)14-17(5)21(23)25-16-19(9-4)13-11-7-2;1-6(2,3)4-5(7)8/h17-19H,6-16H2,1-5H3;4H2,1-3H3 |
| InChIKey | OTBYYILVFCHRJH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate?
The IUPAC name of bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate (CID 90958921) is bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate?
The canonical SMILES for bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate is CCCCC(CC)COC(=O)CC(C)C(=O)OCC(CC)CCCC.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate?
The InChIKey is OTBYYILVFCHRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4.C5H11NO2/c1-6-10-12-18(8-3)15-24-20(22)14-17(5)21(23)25-16-19(9-4)13-11-7-2;1-6(2,3)4-5(7)8/h17-19H,6-16H2,1-5H3;4H2,1-3H3.
What are the key properties of bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate?
bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate has a molecular weight of 473.70 g/mol, XLogP of 3.97, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) 2-methylbutanedioate;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 90958921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).