C19H19N5O — CID 90960110
(7-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-yl)methyl-[4-(1,3-oxazol-5-yl)phenyl]diazene (PubChem CID 90960110) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is (7-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-yl)methyl-[4-(1,3-oxazol-5-yl)phenyl]diazene.
| Compound Name | (7-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-yl)methyl-[4-(1,3-oxazol-5-yl)phenyl]diazene |
|---|---|
| PubChem CID | 90960110 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (7-methyl-6,8-dihydro-5H-2,7-naphthyridin-3-yl)methyl-[4-(1,3-oxazol-5-yl)phenyl]diazene |
| SMILES | CN1CCc2cc(C/N=N/c3ccc(-c4cnco4)cc3)ncc2C1 |
| InChI | InChI=1S/C19H19N5O/c1-24-7-6-15-8-18(21-9-16(15)12-24)10-22-23-17-4-2-14(3-5-17)19-11-20-13-25-19/h2-5,8-9,11,13H,6-7,10,12H2,1H3/b23-22+ |
| InChIKey | ZKSYDFKJMIYQNB-GHVJWSGMSA-N |
| XLogP | 4.01 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|