C24H24ClN3O — CID 90962718
4-chloro-3-(4-pyridin-2-ylphenyl)-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 90962718) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 4-chloro-3-(4-pyridin-2-ylphenyl)-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 4-chloro-3-(4-pyridin-2-ylphenyl)-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 90962718 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-chloro-3-(4-pyridin-2-ylphenyl)-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCCC1)c1ccc(Cl)c(-c2ccc(-c3ccccn3)cc2)c1 |
| InChI | InChI=1S/C24H24ClN3O/c25-22-11-10-20(24(29)27-13-16-28-14-3-4-15-28)17-21(22)18-6-8-19(9-7-18)23-5-1-2-12-26-23/h1-2,5-12,17H,3-4,13-16H2,(H,27,29) |
| InChIKey | KTURTLXDTKARFC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |