C32H35NO7 — CID 90964398
(2S,3S)-2,3-dihydroxy-4-oxo-4-[[(5R,6S)-5-phenyl-6-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]butanoic acid (PubChem CID 90964398) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxy-4-oxo-4-[[(5R,6S)-5-phenyl-6-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]butanoic acid.
| Compound Name | (2S,3S)-2,3-dihydroxy-4-oxo-4-[[(5R,6S)-5-phenyl-6-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 90964398 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (2S,3S)-2,3-dihydroxy-4-oxo-4-[[(5R,6S)-5-phenyl-6-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]butanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@H](O)C(=O)Oc1ccc2c(c1)CC[C@H](c1ccc(OCCN3CCCC3)cc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C32H35NO7/c34-29(31(36)37)30(35)32(38)40-25-13-15-27-23(20-25)10-14-26(28(27)22-6-2-1-3-7-22)21-8-11-24(12-9-21)39-19-18-33-16-4-5-17-33/h1-3,6-9,11-13,15,20,26,28-30,34-35H,4-5,10,14,16-19H2,(H,36,37)/t26-,28+,29+,30+/m1/s1 |
| InChIKey | OKMIIKVNXKCXIZ-ZRJFKUPHSA-N |
| XLogP | 3.73 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|