C10H10N2O — CID 90964677
4-[(5-methyl-3-pyridinyl)methyl]-1,3-oxazole (PubChem CID 90964677) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-[(5-methyl-3-pyridinyl)methyl]-1,3-oxazole.
| Compound Name | 4-[(5-methyl-3-pyridinyl)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 90964677 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 4-[(5-methyl-3-pyridinyl)methyl]-1,3-oxazole |
| SMILES | Cc1cncc(Cc2cocn2)c1 |
| InChI | InChI=1S/C10H10N2O/c1-8-2-9(5-11-4-8)3-10-6-13-7-12-10/h2,4-7H,3H2,1H3 |
| InChIKey | BABUQYJTFXDUDW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |