C16H25BrN2O — CID 90964944
3-[(3-bromophenyl)methyl-[2-(diethylamino)ethyl]amino]propanal (PubChem CID 90964944) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl-[2-(diethylamino)ethyl]amino]propanal.
| Compound Name | 3-[(3-bromophenyl)methyl-[2-(diethylamino)ethyl]amino]propanal |
|---|---|
| PubChem CID | 90964944 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-[(3-bromophenyl)methyl-[2-(diethylamino)ethyl]amino]propanal |
| SMILES | CCN(CC)CCN(CCC=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H25BrN2O/c1-3-18(4-2)10-11-19(9-6-12-20)14-15-7-5-8-16(17)13-15/h5,7-8,12-13H,3-4,6,9-11,14H2,1-2H3 |
| InChIKey | CHFPOUWPDLYIJE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|