4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid

C20H19NO3 — CID 90965076

IUPAC4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid
SMILESCC1(C)Cc2ccccc2C(CC(=O)c2ccc(C(=O)O)cc2)=N1
InChIInChI=1S/C20H19NO3/c1-20(2)12-15-5-3-4-6-16(15)17(21-20)11-18(22)13-7-9-14(10-8-13)19(23)24/h3-10H,11-12H2,1-2H3,(H,23,24)
InChIKeyWYSADUJTGGUBIL-UHFFFAOYSA-N
MW321.38 g/mol
LogP3.78
Rot. Bonds4

About 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid

4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid (PubChem CID 90965076) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid
PubChem CID90965076
Molecular FormulaC20H19NO3
Molecular Weight321.38 g/mol
Exact Mass321.14
IUPAC Name4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid
SMILESCC1(C)Cc2ccccc2C(CC(=O)c2ccc(C(=O)O)cc2)=N1
InChIInChI=1S/C20H19NO3/c1-20(2)12-15-5-3-4-6-16(15)17(21-20)11-18(22)13-7-9-14(10-8-13)19(23)24/h3-10H,11-12H2,1-2H3,(H,23,24)
InChIKeyWYSADUJTGGUBIL-UHFFFAOYSA-N
XLogP3.78
TPSA66.73 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.38
LogP ≤ 53.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid?
The IUPAC name of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid (CID 90965076) is 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid.
What is the SMILES notation for 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid?
The canonical SMILES for 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid is CC1(C)Cc2ccccc2C(CC(=O)c2ccc(C(=O)O)cc2)=N1.
What is the InChIKey of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid?
The InChIKey is WYSADUJTGGUBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO3/c1-20(2)12-15-5-3-4-6-16(15)17(21-20)11-18(22)13-7-9-14(10-8-13)19(23)24/h3-10H,11-12H2,1-2H3,(H,23,24).
What are the key properties of 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid?
4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid has a molecular weight of 321.38 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]benzoic acid is sourced from PubChem (CID 90965076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).