C9H18N2 — CID 90965213
2-ethyl-3,4,6-trimethyl-3,6-dihydro-1H-pyridazine (PubChem CID 90965213) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-ethyl-3,4,6-trimethyl-3,6-dihydro-1H-pyridazine.
| Compound Name | 2-ethyl-3,4,6-trimethyl-3,6-dihydro-1H-pyridazine |
|---|---|
| PubChem CID | 90965213 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-ethyl-3,4,6-trimethyl-3,6-dihydro-1H-pyridazine |
| SMILES | CCN1NC(C)C=C(C)C1C |
| InChI | InChI=1S/C9H18N2/c1-5-11-9(4)7(2)6-8(3)10-11/h6,8-10H,5H2,1-4H3 |
| InChIKey | OVNGRGPROIAYHZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|