C21H22O4 — CID 90966411
methyl 5-(2,3-dihydro-1H-inden-5-yl)-5-oxo-4-phenoxypentanoate (PubChem CID 90966411) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl 5-(2,3-dihydro-1H-inden-5-yl)-5-oxo-4-phenoxypentanoate.
| Compound Name | methyl 5-(2,3-dihydro-1H-inden-5-yl)-5-oxo-4-phenoxypentanoate |
|---|---|
| PubChem CID | 90966411 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl 5-(2,3-dihydro-1H-inden-5-yl)-5-oxo-4-phenoxypentanoate |
| SMILES | COC(=O)CCC(Oc1ccccc1)C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C21H22O4/c1-24-20(22)13-12-19(25-18-8-3-2-4-9-18)21(23)17-11-10-15-6-5-7-16(15)14-17/h2-4,8-11,14,19H,5-7,12-13H2,1H3 |
| InChIKey | NUHIGDTVRQTNMI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |