C14H19F2NO — CID 90970514
(2S)-3-(3,4-difluorophenyl)-2-methoxy-1-propan-2-ylpyrrolidine (PubChem CID 90970514) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is (2S)-3-(3,4-difluorophenyl)-2-methoxy-1-propan-2-ylpyrrolidine.
| Compound Name | (2S)-3-(3,4-difluorophenyl)-2-methoxy-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 90970514 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (2S)-3-(3,4-difluorophenyl)-2-methoxy-1-propan-2-ylpyrrolidine |
| SMILES | CO[C@H]1C(c2ccc(F)c(F)c2)CCN1C(C)C |
| InChI | InChI=1S/C14H19F2NO/c1-9(2)17-7-6-11(14(17)18-3)10-4-5-12(15)13(16)8-10/h4-5,8-9,11,14H,6-7H2,1-3H3/t11?,14-/m0/s1 |
| InChIKey | VYSHTZPTONNPDK-IAXJKZSUSA-N |
| XLogP | 3.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |