C16H14FNO4S — CID 90971823
3-ethenyl-6-[(2-fluorophenyl)sulfonylamino]-2-methylbenzoic acid (PubChem CID 90971823) has the molecular formula C16H14FNO4S and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-ethenyl-6-[(2-fluorophenyl)sulfonylamino]-2-methylbenzoic acid.
| Compound Name | 3-ethenyl-6-[(2-fluorophenyl)sulfonylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 90971823 |
| Molecular Formula | C16H14FNO4S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 3-ethenyl-6-[(2-fluorophenyl)sulfonylamino]-2-methylbenzoic acid |
| SMILES | C=Cc1ccc(NS(=O)(=O)c2ccccc2F)c(C(=O)O)c1C |
| InChI | InChI=1S/C16H14FNO4S/c1-3-11-8-9-13(15(10(11)2)16(19)20)18-23(21,22)14-7-5-4-6-12(14)17/h3-9,18H,1H2,2H3,(H,19,20) |
| InChIKey | RWHVHSQIMZGKAL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |