C20H40O3Si2 — CID 90972005
trans-(3R,4S)-3-(6-methyl-6-trimethylsilyloxyhept-2-enyl)-4-trimethylsilyloxycyclohexan-1-one (PubChem CID 90972005) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is trans-(3R,4S)-3-(6-methyl-6-trimethylsilyloxyhept-2-enyl)-4-trimethylsilyloxycyclohexan-1-one.
| Compound Name | trans-(3R,4S)-3-(6-methyl-6-trimethylsilyloxyhept-2-enyl)-4-trimethylsilyloxycyclohexan-1-one |
|---|---|
| PubChem CID | 90972005 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | trans-(3R,4S)-3-(6-methyl-6-trimethylsilyloxyhept-2-enyl)-4-trimethylsilyloxycyclohexan-1-one |
| SMILES | CC(C)(CCC=CC[C@@H]1CC(=O)CC[C@@H]1O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H40O3Si2/c1-20(2,23-25(6,7)8)15-11-9-10-12-17-16-18(21)13-14-19(17)22-24(3,4)5/h9-10,17,19H,11-16H2,1-8H3/t17-,19+/m1/s1 |
| InChIKey | GYUPWUPNYHFDPF-MJGOQNOKSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|