C22H38O2Si — CID 10090063
(1S,4E,8E,12S,15S)-1,5,9-trimethyl-15-trimethylsilyloxybicyclo[10.2.2]hexadeca-4,8-dien-13-one (PubChem CID 10090063) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (1S,4E,8E,12S,15S)-1,5,9-trimethyl-15-trimethylsilyloxybicyclo[10.2.2]hexadeca-4,8-dien-13-one.
| Compound Name | (1S,4E,8E,12S,15S)-1,5,9-trimethyl-15-trimethylsilyloxybicyclo[10.2.2]hexadeca-4,8-dien-13-one |
|---|---|
| PubChem CID | 10090063 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1S,4E,8E,12S,15S)-1,5,9-trimethyl-15-trimethylsilyloxybicyclo[10.2.2]hexadeca-4,8-dien-13-one |
| SMILES | C/C1=C\CC[C@@]2(C)CC(=O)[C@@H](CC/C(C)=C/CC1)C[C@@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-17-9-7-10-18(2)12-13-19-15-21(24-25(4,5)6)22(3,14-8-11-17)16-20(19)23/h10-11,19,21H,7-9,12-16H2,1-6H3/b17-11+,18-10+/t19-,21-,22-/m0/s1 |
| InChIKey | UJQMMLCSUGYSIB-POWUQGABSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|