C26H25NO4 — CID 90972531
methyl 4-[3-(3,4-dimethylphenyl)imino-3-(3-methylphenoxy)prop-1-enoxy]benzoate (PubChem CID 90972531) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 4-[3-(3,4-dimethylphenyl)imino-3-(3-methylphenoxy)prop-1-enoxy]benzoate.
| Compound Name | methyl 4-[3-(3,4-dimethylphenyl)imino-3-(3-methylphenoxy)prop-1-enoxy]benzoate |
|---|---|
| PubChem CID | 90972531 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | methyl 4-[3-(3,4-dimethylphenyl)imino-3-(3-methylphenoxy)prop-1-enoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC=C/C(=N\c2ccc(C)c(C)c2)Oc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-18-6-5-7-24(16-18)31-25(27-22-11-8-19(2)20(3)17-22)14-15-30-23-12-9-21(10-13-23)26(28)29-4/h5-17H,1-4H3/b15-14?,27-25+ |
| InChIKey | VIMKEMVAMIUIEL-MRCRTOGGSA-N |
| XLogP | 6.10 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|