C24H21F2NO2 — CID 91181507
(3-methylphenyl) 3-(3,4-difluorophenoxy)-N-(3,4-dimethylphenyl)prop-2-enimidate (PubChem CID 91181507) has the molecular formula C24H21F2NO2 and a molecular weight of 393.43 g/mol. Its IUPAC name is (3-methylphenyl) 3-(3,4-difluorophenoxy)-N-(3,4-dimethylphenyl)prop-2-enimidate.
| Compound Name | (3-methylphenyl) 3-(3,4-difluorophenoxy)-N-(3,4-dimethylphenyl)prop-2-enimidate |
|---|---|
| PubChem CID | 91181507 |
| Molecular Formula | C24H21F2NO2 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (3-methylphenyl) 3-(3,4-difluorophenoxy)-N-(3,4-dimethylphenyl)prop-2-enimidate |
| SMILES | Cc1cccc(O/C(C=COc2ccc(F)c(F)c2)=N/c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H21F2NO2/c1-16-5-4-6-21(13-16)29-24(27-19-8-7-17(2)18(3)14-19)11-12-28-20-9-10-22(25)23(26)15-20/h4-15H,1-3H3/b12-11?,27-24+ |
| InChIKey | ZHWDNOYLKVYSST-AFBXSJHLSA-N |
| XLogP | 6.59 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|