C14H28N2 — CID 90973975
1-(cyclohexen-1-yl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine (PubChem CID 90973975) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine.
| Compound Name | 1-(cyclohexen-1-yl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 90973975 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine |
| SMILES | CC(C)(C)CC(C)(C)NNC1=CCCCC1 |
| InChI | InChI=1S/C14H28N2/c1-13(2,3)11-14(4,5)16-15-12-9-7-6-8-10-12/h9,15-16H,6-8,10-11H2,1-5H3 |
| InChIKey | GGPLEMVDFYGJPQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|