C9H18N2 — CID 91434113
1,1-dimethyl-2-(3-methylcyclohexen-1-yl)hydrazine (PubChem CID 91434113) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,1-dimethyl-2-(3-methylcyclohexen-1-yl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(3-methylcyclohexen-1-yl)hydrazine |
|---|---|
| PubChem CID | 91434113 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1,1-dimethyl-2-(3-methylcyclohexen-1-yl)hydrazine |
| SMILES | CC1C=C(NN(C)C)CCC1 |
| InChI | InChI=1S/C9H18N2/c1-8-5-4-6-9(7-8)10-11(2)3/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | UFKBZWJGMKHBNU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|