C14H27N3 — CID 167250987
(Z)-1-[amino-[(2-methylcyclohex-2-en-1-yl)methyl]amino]-4-methylpent-1-en-2-amine (PubChem CID 167250987) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (Z)-1-[amino-[(2-methylcyclohex-2-en-1-yl)methyl]amino]-4-methylpent-1-en-2-amine.
| Compound Name | (Z)-1-[amino-[(2-methylcyclohex-2-en-1-yl)methyl]amino]-4-methylpent-1-en-2-amine |
|---|---|
| PubChem CID | 167250987 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (Z)-1-[amino-[(2-methylcyclohex-2-en-1-yl)methyl]amino]-4-methylpent-1-en-2-amine |
| SMILES | CC1=CCCCC1CN(N)/C=C(\N)CC(C)C |
| InChI | InChI=1S/C14H27N3/c1-11(2)8-14(15)10-17(16)9-13-7-5-4-6-12(13)3/h6,10-11,13H,4-5,7-9,15-16H2,1-3H3/b14-10- |
| InChIKey | OIPHJDBPFVHEGF-UVTDQMKNSA-N |
| XLogP | 2.75 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|