C31H27Cl2N3O4 — CID 90976110
3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-7-(pyridin-4-ylmethyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide (PubChem CID 90976110) has the molecular formula C31H27Cl2N3O4 and a molecular weight of 576.48 g/mol. Its IUPAC name is 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-7-(pyridin-4-ylmethyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide.
| Compound Name | 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-7-(pyridin-4-ylmethyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 90976110 |
| Molecular Formula | C31H27Cl2N3O4 |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-7-(pyridin-4-ylmethyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-8-carboxamide |
| SMILES | NC(=O)C1Cc2cc3c(cc2CN1Cc1ccncc1)OC(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)CO3 |
| InChI | InChI=1S/C31H27Cl2N3O4/c32-25-6-1-20(11-26(25)33)17-38-24-4-2-21(3-5-24)30-18-39-28-13-22-12-27(31(34)37)36(15-19-7-9-35-10-8-19)16-23(22)14-29(28)40-30/h1-11,13-14,27,30H,12,15-18H2,(H2,34,37) |
| InChIKey | AQRGDVWYEQXYMZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |