C31H31Cl2NO7 — CID 58327259
7-O-tert-butyl 8-O-methyl (3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-7,8-dicarboxylate (PubChem CID 58327259) has the molecular formula C31H31Cl2NO7 and a molecular weight of 600.50 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-7,8-dicarboxylate |
|---|---|
| PubChem CID | 58327259 |
| Molecular Formula | C31H31Cl2NO7 |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc3c(cc2CN1C(=O)OC(C)(C)C)O[C@H](c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)CO3 |
| InChI | InChI=1S/C31H31Cl2NO7/c1-31(2,3)41-30(36)34-15-21-14-27-26(13-20(21)12-25(34)29(35)37-4)39-17-28(40-27)19-6-8-22(9-7-19)38-16-18-5-10-23(32)24(33)11-18/h5-11,13-14,25,28H,12,15-17H2,1-4H3/t25-,28-/m0/s1 |
| InChIKey | XPCPSCNPPWMOKH-LSYYVWMOSA-N |
| XLogP | 6.92 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |