C26H32N2O6 — CID 142598552
9-O-tert-butyl 8-O-methyl (2S,8S)-2-(4-hydroxyphenyl)-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8,9-dicarboxylate (PubChem CID 142598552) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is 9-O-tert-butyl 8-O-methyl (2S,8S)-2-(4-hydroxyphenyl)-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 8-O-methyl (2S,8S)-2-(4-hydroxyphenyl)-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8,9-dicarboxylate |
|---|---|
| PubChem CID | 142598552 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 9-O-tert-butyl 8-O-methyl (2S,8S)-2-(4-hydroxyphenyl)-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8,9-dicarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc3c(cc2CN1C(=O)OC(C)(C)C)O[C@@H](c1ccc(O)cc1)CN(C)C3 |
| InChI | InChI=1S/C26H32N2O6/c1-26(2,3)34-25(31)28-14-18-12-22-19(10-17(18)11-21(28)24(30)32-5)13-27(4)15-23(33-22)16-6-8-20(29)9-7-16/h6-10,12,21,23,29H,11,13-15H2,1-5H3/t21-,23+/m0/s1 |
| InChIKey | OFZFGZPARSEPCC-JTHBVZDNSA-N |
| XLogP | 3.79 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |