C32H32Cl2N2O7 — CID 66922871
7-O-tert-butyl 8-O-methyl 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate (PubChem CID 66922871) has the molecular formula C32H32Cl2N2O7 and a molecular weight of 627.52 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 66922871 |
| Molecular Formula | C32H32Cl2N2O7 |
| Molecular Weight | 627.52 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl 3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate |
| SMILES | COC(=O)C1Cc2cc3c(cc2CN1C(=O)OC(C)(C)C)OC(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C(=O)N3C |
| InChI | InChI=1S/C32H32Cl2N2O7/c1-32(2,3)43-31(39)36-16-21-15-27-25(13-20(21)14-26(36)30(38)40-5)35(4)29(37)28(42-27)19-7-9-22(10-8-19)41-17-18-6-11-23(33)24(34)12-18/h6-13,15,26,28H,14,16-17H2,1-5H3 |
| InChIKey | SUGZPSIGVCAQSR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |