C35H32Cl2N2O5 — CID 59337411
(3S,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carboxylic acid (PubChem CID 59337411) has the molecular formula C35H32Cl2N2O5 and a molecular weight of 631.56 g/mol. Its IUPAC name is (3S,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carboxylic acid.
| Compound Name | (3S,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carboxylic acid |
|---|---|
| PubChem CID | 59337411 |
| Molecular Formula | C35H32Cl2N2O5 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | (3S,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carboxylic acid |
| SMILES | CC[C@@H](c1ccccc1)N1Cc2cc3c(cc2C[C@H]1C(=O)O)N(C)C(=O)[C@H](c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)O3 |
| InChI | InChI=1S/C35H32Cl2N2O5/c1-3-29(22-7-5-4-6-8-22)39-19-25-18-32-30(16-24(25)17-31(39)35(41)42)38(2)34(40)33(44-32)23-10-12-26(13-11-23)43-20-21-9-14-27(36)28(37)15-21/h4-16,18,29,31,33H,3,17,19-20H2,1-2H3,(H,41,42)/t29-,31-,33-/m0/s1 |
| InChIKey | CADSDLSKDZVATC-WXWREJFYSA-N |
| XLogP | 7.63 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |