C38H37Cl2N3O6 — CID 154189056
2-[[(3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoic acid (PubChem CID 154189056) has the molecular formula C38H37Cl2N3O6 and a molecular weight of 702.64 g/mol. Its IUPAC name is 2-[[(3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[(3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 154189056 |
| Molecular Formula | C38H37Cl2N3O6 |
| Molecular Weight | 702.64 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | 2-[[(3R,8S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-2-oxo-7-[(1S)-1-phenylpropyl]-8,9-dihydro-6H-pyrido[4,3-g][1,4]benzoxazine-8-carbonyl]amino]propanoic acid |
| SMILES | CC[C@@H](c1ccccc1)N1Cc2cc3c(cc2C[C@H]1C(=O)NC(C)C(=O)O)N(C)C(=O)[C@@H](c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)O3 |
| InChI | InChI=1S/C38H37Cl2N3O6/c1-4-31(24-8-6-5-7-9-24)43-20-27-19-34-32(17-26(27)18-33(43)36(44)41-22(2)38(46)47)42(3)37(45)35(49-34)25-11-13-28(14-12-25)48-21-23-10-15-29(39)30(40)16-23/h5-17,19,22,31,33,35H,4,18,20-21H2,1-3H3,(H,41,44)(H,46,47)/t22?,31-,33-,35+/m0/s1 |
| InChIKey | HJWMBVSOYBSPAM-BRQYNPAGSA-N |
| XLogP | 7.14 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |