C32H34Cl2N2O6 — CID 66719521
7-O-tert-butyl 8-O-methyl (3S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-3,6,8,9-tetrahydro-2H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate (PubChem CID 66719521) has the molecular formula C32H34Cl2N2O6 and a molecular weight of 613.54 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (3S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-3,6,8,9-tetrahydro-2H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (3S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-3,6,8,9-tetrahydro-2H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 66719521 |
| Molecular Formula | C32H34Cl2N2O6 |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (3S)-3-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-1-methyl-3,6,8,9-tetrahydro-2H-pyrido[4,3-g][1,4]benzoxazine-7,8-dicarboxylate |
| SMILES | COC(=O)C1Cc2cc3c(cc2CN1C(=O)OC(C)(C)C)O[C@@H](c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)CN3C |
| InChI | InChI=1S/C32H34Cl2N2O6/c1-32(2,3)42-31(38)36-16-22-15-28-26(13-21(22)14-27(36)30(37)39-5)35(4)17-29(41-28)20-7-9-23(10-8-20)40-18-19-6-11-24(33)25(34)12-19/h6-13,15,27,29H,14,16-18H2,1-5H3/t27?,29-/m1/s1 |
| InChIKey | SXZAJJPHAKPDGL-ZBAATNBSSA-N |
| XLogP | 6.98 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|