C17H12N4O4 — CID 9097901
(4-methyl-2-oxochromen-7-yl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 9097901) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 9097901 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)c3nc4nccc(C)n4n3)ccc12 |
| InChI | InChI=1S/C17H12N4O4/c1-9-7-14(22)25-13-8-11(3-4-12(9)13)24-16(23)15-19-17-18-6-5-10(2)21(17)20-15/h3-8H,1-2H3 |
| InChIKey | NFRFJWBZLKVRRE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|