C16H27N3OS — CID 9098018
3-[3-(dimethylamino)propyl]-1-[(2-methoxy-5-methylphenyl)methyl]-1-methylthiourea (PubChem CID 9098018) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-1-[(2-methoxy-5-methylphenyl)methyl]-1-methylthiourea.
| Compound Name | 3-[3-(dimethylamino)propyl]-1-[(2-methoxy-5-methylphenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 9098018 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-1-[(2-methoxy-5-methylphenyl)methyl]-1-methylthiourea |
| SMILES | COc1ccc(C)cc1CN(C)C(=S)NCCCN(C)C |
| InChI | InChI=1S/C16H27N3OS/c1-13-7-8-15(20-5)14(11-13)12-19(4)16(21)17-9-6-10-18(2)3/h7-8,11H,6,9-10,12H2,1-5H3,(H,17,21) |
| InChIKey | HPKATLHKGYOSSK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|