C15H19FN2O2 — CID 90980273
ethane;methyl 2-[3-[(3-fluorophenyl)methyl]imidazol-4-yl]acetate (PubChem CID 90980273) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is ethane;methyl 2-[3-[(3-fluorophenyl)methyl]imidazol-4-yl]acetate.
| Compound Name | ethane;methyl 2-[3-[(3-fluorophenyl)methyl]imidazol-4-yl]acetate |
|---|---|
| PubChem CID | 90980273 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | ethane;methyl 2-[3-[(3-fluorophenyl)methyl]imidazol-4-yl]acetate |
| SMILES | CC.COC(=O)Cc1cncn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C13H13FN2O2.C2H6/c1-18-13(17)6-12-7-15-9-16(12)8-10-3-2-4-11(14)5-10;1-2/h2-5,7,9H,6,8H2,1H3;1-2H3 |
| InChIKey | ZLPVYLCZDWUUGH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |