C25H23N3O2 — CID 9098536
N,3-dibenzyl-N-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 9098536) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N,3-dibenzyl-N-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N,3-dibenzyl-N-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9098536 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N,3-dibenzyl-N-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1nn(Cc2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H23N3O2/c1-2-27(17-19-11-5-3-6-12-19)25(30)23-21-15-9-10-16-22(21)24(29)28(26-23)18-20-13-7-4-8-14-20/h3-16H,2,17-18H2,1H3 |
| InChIKey | UJRXGFIUNUDRIP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |