C16H28O — CID 90986367
(1E)-1-methoxy-3,7,11-trimethyldodeca-1,6,10-triene (PubChem CID 90986367) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (1E)-1-methoxy-3,7,11-trimethyldodeca-1,6,10-triene.
| Compound Name | (1E)-1-methoxy-3,7,11-trimethyldodeca-1,6,10-triene |
|---|---|
| PubChem CID | 90986367 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (1E)-1-methoxy-3,7,11-trimethyldodeca-1,6,10-triene |
| SMILES | CO/C=C/C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C16H28O/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-17-5/h8,10,12-13,16H,6-7,9,11H2,1-5H3/b13-12+,15-10? |
| InChIKey | BAQMMKYEYBGINL-NQKZQFAOSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|