C11H18 — CID 90988360
5,6-diethylcyclohepta-1,3-diene (PubChem CID 90988360) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 5,6-diethylcyclohepta-1,3-diene.
| Compound Name | 5,6-diethylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 90988360 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 5,6-diethylcyclohepta-1,3-diene |
| SMILES | CCC1C=CC=CCC1CC |
| InChI | InChI=1S/C11H18/c1-3-10-8-6-5-7-9-11(10)4-2/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | GDVWMGXEPSPNMZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |