C16H24 — CID 175624655
3-[(2-ethylcyclopent-3-en-1-yl)methyl]-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 175624655) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 3-[(2-ethylcyclopent-3-en-1-yl)methyl]-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | 3-[(2-ethylcyclopent-3-en-1-yl)methyl]-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 175624655 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 3-[(2-ethylcyclopent-3-en-1-yl)methyl]-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | CCC1C=CCC1CC1CCC2C=CCC21 |
| InChI | InChI=1S/C16H24/c1-2-12-5-3-7-14(12)11-15-10-9-13-6-4-8-16(13)15/h3-6,12-16H,2,7-11H2,1H3 |
| InChIKey | OYFLTBHCUWWHFO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|