C10H15F2NO — CID 90988914
(5R)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one (PubChem CID 90988914) has the molecular formula C10H15F2NO and a molecular weight of 203.23 g/mol. Its IUPAC name is (5R)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one.
| Compound Name | (5R)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 90988914 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (5R)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one |
| SMILES | O=C1CN[C@@H](C2CCC(F)C(F)C2)C1 |
| InChI | InChI=1S/C10H15F2NO/c11-8-2-1-6(3-9(8)12)10-4-7(14)5-13-10/h6,8-10,13H,1-5H2/t6?,8?,9?,10-/m1/s1 |
| InChIKey | ACFRCHNITOVBJE-NEEVAGLGSA-N |
| XLogP | 1.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |