C19H26F3N3O2 — CID 90988977
(2S)-2-amino-4-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]pentan-1-one (PubChem CID 90988977) has the molecular formula C19H26F3N3O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]pentan-1-one.
| Compound Name | (2S)-2-amino-4-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 90988977 |
| Molecular Formula | C19H26F3N3O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2S)-2-amino-4-methyl-1-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]pentan-1-one |
| SMILES | CC(C)C[C@H](N)C(=O)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H26F3N3O2/c1-13(2)10-17(23)18(26)25-8-6-16(7-9-25)24-27-12-14-4-3-5-15(11-14)19(20,21)22/h3-6,11,13,17,24H,7-10,12,23H2,1-2H3/t17-/m0/s1 |
| InChIKey | NNKLGGGHIDWADH-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|