C17H18S — CID 90990047
3,4-diethyl-2-(1H-inden-1-yl)thiophene (PubChem CID 90990047) has the molecular formula C17H18S and a molecular weight of 254.40 g/mol. Its IUPAC name is 3,4-diethyl-2-(1H-inden-1-yl)thiophene.
| Compound Name | 3,4-diethyl-2-(1H-inden-1-yl)thiophene |
|---|---|
| PubChem CID | 90990047 |
| Molecular Formula | C17H18S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3,4-diethyl-2-(1H-inden-1-yl)thiophene |
| SMILES | CCc1csc(C2C=Cc3ccccc32)c1CC |
| InChI | InChI=1S/C17H18S/c1-3-12-11-18-17(14(12)4-2)16-10-9-13-7-5-6-8-15(13)16/h5-11,16H,3-4H2,1-2H3 |
| InChIKey | LUQLCFIBLZVXLB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |