C17H31N3O5 — CID 90992121
5-oxo-3-[2-oxo-2-(propylamino)ethyl]-5-(propylamino)-3-(propylcarbamoyl)pentanoic acid (PubChem CID 90992121) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-oxo-3-[2-oxo-2-(propylamino)ethyl]-5-(propylamino)-3-(propylcarbamoyl)pentanoic acid.
| Compound Name | 5-oxo-3-[2-oxo-2-(propylamino)ethyl]-5-(propylamino)-3-(propylcarbamoyl)pentanoic acid |
|---|---|
| PubChem CID | 90992121 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 5-oxo-3-[2-oxo-2-(propylamino)ethyl]-5-(propylamino)-3-(propylcarbamoyl)pentanoic acid |
| SMILES | CCCNC(=O)CC(CC(=O)O)(CC(=O)NCCC)C(=O)NCCC |
| InChI | InChI=1S/C17H31N3O5/c1-4-7-18-13(21)10-17(12-15(23)24,16(25)20-9-6-3)11-14(22)19-8-5-2/h4-12H2,1-3H3,(H,18,21)(H,19,22)(H,20,25)(H,23,24) |
| InChIKey | XSBHYZCYPXNKLJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |