C20H37N3O5 — CID 91091883
5-(butylamino)-3-[2-(butylamino)-2-oxoethyl]-3-(butylcarbamoyl)-5-oxopentanoic acid (PubChem CID 91091883) has the molecular formula C20H37N3O5 and a molecular weight of 399.53 g/mol. Its IUPAC name is 5-(butylamino)-3-[2-(butylamino)-2-oxoethyl]-3-(butylcarbamoyl)-5-oxopentanoic acid.
| Compound Name | 5-(butylamino)-3-[2-(butylamino)-2-oxoethyl]-3-(butylcarbamoyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91091883 |
| Molecular Formula | C20H37N3O5 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 5-(butylamino)-3-[2-(butylamino)-2-oxoethyl]-3-(butylcarbamoyl)-5-oxopentanoic acid |
| SMILES | CCCCNC(=O)CC(CC(=O)O)(CC(=O)NCCCC)C(=O)NCCCC |
| InChI | InChI=1S/C20H37N3O5/c1-4-7-10-21-16(24)13-20(15-18(26)27,19(28)23-12-9-6-3)14-17(25)22-11-8-5-2/h4-15H2,1-3H3,(H,21,24)(H,22,25)(H,23,28)(H,26,27) |
| InChIKey | YYOAKTNRNRXAQA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|