C27H32N4O4S — CID 90993185
4-[3-[[4-[(2-methylbenzoyl)amino]naphthalen-1-yl]sulfonylamino]propyl]piperidine-1-carboxamide (PubChem CID 90993185) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is 4-[3-[[4-[(2-methylbenzoyl)amino]naphthalen-1-yl]sulfonylamino]propyl]piperidine-1-carboxamide.
| Compound Name | 4-[3-[[4-[(2-methylbenzoyl)amino]naphthalen-1-yl]sulfonylamino]propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90993185 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 4-[3-[[4-[(2-methylbenzoyl)amino]naphthalen-1-yl]sulfonylamino]propyl]piperidine-1-carboxamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NCCCC2CCN(C(N)=O)CC2)c2ccccc12 |
| InChI | InChI=1S/C27H32N4O4S/c1-19-7-2-3-9-21(19)26(32)30-24-12-13-25(23-11-5-4-10-22(23)24)36(34,35)29-16-6-8-20-14-17-31(18-15-20)27(28)33/h2-5,7,9-13,20,29H,6,8,14-18H2,1H3,(H2,28,33)(H,30,32) |
| InChIKey | QMMZIKQEXZNVIZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|