C17H21ClN2O3S — CID 90994180
butyl 2-[(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methoxy]acetate (PubChem CID 90994180) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is butyl 2-[(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methoxy]acetate.
| Compound Name | butyl 2-[(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methoxy]acetate |
|---|---|
| PubChem CID | 90994180 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | butyl 2-[(4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methoxy]acetate |
| SMILES | CCCCOC(=O)COCc1nc(Cl)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-2-3-8-23-14(21)10-22-9-13-19-16(18)15-11-6-4-5-7-12(11)24-17(15)20-13/h2-10H2,1H3 |
| InChIKey | YANLGBKGTAERHE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|