About 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone
1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone (PubChem CID 90994352) has the molecular formula C10H15NO5
and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone.
Molecular Properties
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone |
| PubChem CID | 90994352 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone |
| SMILES | CCOCCOCC(=O)n1c(O)ccc1O |
| InChI | InChI=1S/C10H15NO5/c1-2-15-5-6-16-7-10(14)11-8(12)3-4-9(11)13/h3-4,12-13H,2,5-7H2,1H3 |
| InChIKey | WVNQRHHXOAOQHG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone?
The IUPAC name of 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone (CID 90994352) is 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone.
What is the SMILES notation for 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone?
The canonical SMILES for 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone is CCOCCOCC(=O)n1c(O)ccc1O.
What is the InChIKey of 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone?
The InChIKey is WVNQRHHXOAOQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c1-2-15-5-6-16-7-10(14)11-8(12)3-4-9(11)13/h3-4,12-13H,2,5-7H2,1H3.
What are the key properties of 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone?
1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone has a molecular weight of 229.23 g/mol, XLogP of 0.59, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone is sourced from PubChem (CID 90994352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).