C10H15NO5 — CID 90994352
1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone (PubChem CID 90994352) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone |
|---|---|
| PubChem CID | 90994352 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)-2-(2-ethoxyethoxy)ethanone |
| SMILES | CCOCCOCC(=O)n1c(O)ccc1O |
| InChI | InChI=1S/C10H15NO5/c1-2-15-5-6-16-7-10(14)11-8(12)3-4-9(11)13/h3-4,12-13H,2,5-7H2,1H3 |
| InChIKey | WVNQRHHXOAOQHG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|