C14H23N3O5S — CID 90997966
3-[(4-aminophenyl)sulfonyl-(2-hydroxy-2-methylpropyl)amino]propylcarbamic acid (PubChem CID 90997966) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-[(4-aminophenyl)sulfonyl-(2-hydroxy-2-methylpropyl)amino]propylcarbamic acid.
| Compound Name | 3-[(4-aminophenyl)sulfonyl-(2-hydroxy-2-methylpropyl)amino]propylcarbamic acid |
|---|---|
| PubChem CID | 90997966 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 3-[(4-aminophenyl)sulfonyl-(2-hydroxy-2-methylpropyl)amino]propylcarbamic acid |
| SMILES | CC(C)(O)CN(CCCNC(=O)O)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H23N3O5S/c1-14(2,20)10-17(9-3-8-16-13(18)19)23(21,22)12-6-4-11(15)5-7-12/h4-7,16,20H,3,8-10,15H2,1-2H3,(H,18,19) |
| InChIKey | YCJPHSANONHBAA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|