C11H10N2O4 — CID 91000148
2-[3-(furan-2-yl)-2-methyl-6-oxopyrazin-1-yl]acetic acid (PubChem CID 91000148) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-2-methyl-6-oxopyrazin-1-yl]acetic acid.
| Compound Name | 2-[3-(furan-2-yl)-2-methyl-6-oxopyrazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 91000148 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[3-(furan-2-yl)-2-methyl-6-oxopyrazin-1-yl]acetic acid |
| SMILES | Cc1c(-c2ccco2)ncc(=O)n1CC(=O)O |
| InChI | InChI=1S/C11H10N2O4/c1-7-11(8-3-2-4-17-8)12-5-9(14)13(7)6-10(15)16/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | JJLRPVXFZPFWCB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |