C24H26N2O2 — CID 91001754
2,3-dimethyl-N-[(4-methylphenyl)methyl]-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,10-pentaene-10-carboxamide;ethane (PubChem CID 91001754) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(4-methylphenyl)methyl]-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,10-pentaene-10-carboxamide;ethane.
| Compound Name | 2,3-dimethyl-N-[(4-methylphenyl)methyl]-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,10-pentaene-10-carboxamide;ethane |
|---|---|
| PubChem CID | 91001754 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2,3-dimethyl-N-[(4-methylphenyl)methyl]-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,10-pentaene-10-carboxamide;ethane |
| SMILES | CC.Cc1ccc(CNC(=O)c2cn3c(C)c(C)c4cccc(c2=O)c43)cc1 |
| InChI | InChI=1S/C22H20N2O2.C2H6/c1-13-7-9-16(10-8-13)11-23-22(26)19-12-24-15(3)14(2)17-5-4-6-18(20(17)24)21(19)25;1-2/h4-10,12H,11H2,1-3H3,(H,23,26);1-2H3 |
| InChIKey | IVVGSCIBCHUPCC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |